![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| #Signal_Bars_v8.ex4 | 2013-06-06 13:12 | 38K | |
| 9Squared MM.ex4 | 2013-06-06 13:12 | 13K | |
| Bollinger Bands_Stop_v2 .ex4 | 2013-06-06 13:12 | 7.2K | |
| Dolly Graphics_v13.ex4 | 2013-06-06 13:12 | 182K | |
| FX Multi-Meter III.ex4 | 2013-06-06 13:12 | 251K | |
| FXOE-Combo.ex4 | 2013-06-06 13:12 | 17K | |
| FXOE-ITrend.ex4 | 2013-06-06 13:12 | 5.1K | |
| FXOE-ITrendHisto.ex4 | 2013-06-06 13:12 | 5.1K | |
| FXOE-Juice.ex4 | 2013-06-06 13:12 | 4.5K | |
| FXOE-LRSI.ex4 | 2013-06-06 13:12 | 4.6K | |
| FXOE-SHIChannel.ex4 | 2013-06-06 13:12 | 9.5K | |
| FXOE-SHISlope.ex4 | 2013-06-06 13:12 | 8.9K | |
| FerruFx_Multi_info THV.ex4 | 2013-06-06 13:12 | 81K | |
| GP_Clock.ex4 | 2013-06-06 13:12 | 2.4K | |
| Gann_HiLo_Activator_v2.ex4 | 2013-06-06 13:12 | 2.4K | |
| Heiken Ashi Smoothed_v2.ex4 | 2013-06-06 13:12 | 4.6K | |
| MACD_Colored_v105.ex4 | 2013-06-06 13:12 | 20K | |
| Magnified Market Price.ex4 | 2013-06-06 13:12 | 2.9K | |
| PriceChannel_Stop_v1.2.ex4 | 2013-06-06 13:12 | 7.6K | |
| SEFC05.ex4 | 2013-06-06 13:12 | 3.1K | |
| SEFC084.ex4 | 2013-06-06 13:12 | 5.1K | |
| SEFC10.ex4 | 2013-06-06 13:12 | 16K | |
| SHI_SilverTrendSig.ex4 | 2013-06-06 13:12 | 3.5K | |
| SS2009_B.ex4 | 2013-06-06 13:12 | 3.6K | |
| SS2009_C.ex4 | 2013-06-06 13:12 | 3.4K | |
| SnakeBorders.ex4 | 2013-06-06 13:12 | 9.9K | |
| SnakeForce.ex4 | 2013-06-06 13:12 | 7.5K | |
| Status Monitor V1.2.ex4 | 2013-06-06 13:12 | 7.3K | |
| SuperTrendV1.ex4 | 2013-06-06 13:12 | 2.4K | |
| SuperTriggerV1.ex4 | 2013-06-06 13:12 | 4.0K | |
| Support and Resistance (Barry).ex4 | 2013-06-06 13:12 | 2.3K | |
| TanganJiwa.ex4 | 2013-06-06 13:12 | 5.3K | |
| The 80's HEIKEN 1 hour.ex4 | 2013-06-06 13:12 | 4.6K | |
| ULTRA_TREND.ex4 | 2013-06-06 13:12 | 20K | |
| [i]2ma.ex4 | 2013-06-06 13:12 | 2.7K | |
| [i]2ma_divergencetrader_ron_mt4_v04.ex4 | 2013-06-06 13:12 | 3.4K | |
| [i]2rsixover.ex4 | 2013-06-06 13:12 | 2.9K | |
| [i]2rsixover_v03.ex4 | 2013-06-06 13:12 | 3.4K | |
| [i]3masame.ex4 | 2013-06-06 13:12 | 2.8K | |
| [i]4pma_1_[1].psars.rgrssn.std.v3.ex4 | 2013-06-06 13:12 | 55K | |
| [i] altrtrend.ex4 | 2013-06-06 13:12 | 3.9K | |
| [i]ao_mfi_ma_ron_01.ex4 | 2013-06-06 13:12 | 3.4K | |
| [i]bolltrade_ron_mt4.ex4 | 2013-06-06 13:12 | 3.0K | |
| [i]gordagoelder.ex4 | 2013-06-06 13:12 | 4.3K | |
| [i]obvmod.ex4 | 2013-06-06 13:12 | 1.9K | |
| [i]rsi_macd_ma_ron_01.ex4 | 2013-06-06 13:12 | 3.7K | |
| [i]silvertrend_ron_mt4_v02.ex4 | 2013-06-06 13:12 | 3.2K | |
| [i] stepma_stoch_v1.ex4 | 2013-06-06 13:12 | 5.9K | |
| [i]test_histo2.ex4 | 2013-06-06 13:12 | 2.6K | |
| [indi]_sdx-zonebreakout-lud-z1-v2.ex4 | 2013-06-06 13:12 | 8.5K | |
| [indi]_sdx-zonebreakout-lud-z2-v2.ex4 | 2013-06-06 13:12 | 8.8K | |
| ^dyn_alllevels.ex4 | 2013-06-06 13:12 | 6.9K | |
| ^dyn_pivot.ex4 | 2013-06-06 13:12 | 4.8K | |
| ^dyn_range.ex4 | 2013-06-06 13:12 | 5.8K | |
| ^dyn_range2.ex4 | 2013-06-06 13:12 | 5.8K | |
| ^mfp mm lines.ex4 | 2013-06-06 13:12 | 10K | |
| ^pivot_alllevels.ex4 | 2013-06-06 13:12 | 5.6K | |
| ^pivot_pp.ex4 | 2013-06-06 13:12 | 3.8K | |
| ^pivot_ressup.ex4 | 2013-06-06 13:12 | 4.5K | |
| ^pivot_ressup2.ex4 | 2013-06-06 13:12 | 4.5K | |
| __madrogoldenfilter.ex4 | 2013-06-06 13:12 | 6.4K | |
| _i_ef_distance.ex4 | 2013-06-06 13:12 | 2.9K | |
| _i_fxgauge.ex4 | 2013-06-06 13:12 | 14K | |
| _i_fxgaugemas.ex4 | 2013-06-06 13:12 | 3.5K | |
| _ma_crossover_alert_.ex4 | 2013-06-06 13:12 | 10K | |
| _max_stops_multi_v1.0.ex4 | 2013-06-06 13:12 | 4.5K | |
| _max_stops_v1.1.ex4 | 2013-06-06 13:12 | 4.3K | |
| _mtf_candles.ex4 | 2013-06-06 13:12 | 3.7K | |
| _mtf_movingaverage.ex4 | 2013-06-06 13:12 | 3.1K | |
| _mtf_trix.ex4 | 2013-06-06 13:12 | 5.0K | |
| _signal_bars_v1.ex4 | 2013-06-06 13:12 | 36K | |
| _signal_bars_v3_daily.ex4 | 2013-06-06 13:12 | 41K | |
| _tdtlmodifiedbr.ex4 | 2013-06-06 13:12 | 28K | |
| _tro_mid.ex4 | 2013-06-06 13:12 | 12K | |
| _tro_multi_meter_block.ex4 | 2013-06-06 13:12 | 8.5K | |
| _tro_multi_meter_macd.ex4 | 2013-06-06 13:12 | 9.7K | |
| _tro_multi_meter_macrossover.ex4 | 2013-06-06 13:12 | 8.5K | |
| _tro_multi_meter_rsi.ex4 | 2013-06-06 13:12 | 8.3K | |
| myfxovereasy.ex4 | 2013-06-06 13:12 | 4.0K | |
| slope.ex4 | 2013-06-06 13:12 | 11K | |
| slope direction line.ex4 | 2013-06-06 13:12 | 4.0K | |
| slopedirectionline.ex4 | 2013-06-06 13:12 | 4.0K | |
| sma-crossover_signal.ex4 | 2013-06-06 13:12 | 3.3K | |
| smadx.ex4 | 2013-06-06 13:12 | 4.2K | |
| smadxbars.ex4 | 2013-06-06 13:12 | 3.1K | |
| smartass2.ex4 | 2013-06-06 13:12 | 8.4K | |
| smart s.ex4 | 2013-06-06 13:12 | 12K | |
| smatr.ex4 | 2013-06-06 13:12 | 4.4K | |
| smcci.ex4 | 2013-06-06 13:12 | 2.5K | |
| smcci_test.ex4 | 2013-06-06 13:12 | 3.1K | |
| smc trend.ex4 | 2013-06-06 13:12 | 3.0K | |
| smi.ex4 | 2013-06-06 13:12 | 4.5K | |
| smi_color.ex4 | 2013-06-06 13:12 | 3.7K | |
| smi_correct.ex4 | 2013-06-06 13:12 | 5.0K | |
| smi_helper.ex4 | 2013-06-06 13:12 | 4.0K | |
| smi_v4.ex4 | 2013-06-06 13:12 | 3.1K | |
| smma-crossover_signal.ex4 | 2013-06-06 13:12 | 3.3K | |
| smpricebend-t01.ex4 | 2013-06-06 13:12 | 3.6K | |
| smwpr_test.ex4 | 2013-06-06 13:12 | 3.1K | |
| snake_in_borders.ex4 | 2013-06-06 13:12 | 7.5K | |
| snapshotea.ex4 | 2013-06-06 13:12 | 2.4K | |
| snapshoti.ex4 | 2013-06-06 13:12 | 2.6K | |
| snapshoti1.ex4 | 2013-06-06 13:12 | 5.0K | |
| sniper_trend_b.ex4 | 2013-06-06 13:12 | 3.3K | |
| snipper.ex4 | 2013-06-06 13:12 | 3.5K | |
| solar winds.ex4 | 2013-06-06 13:12 | 3.3K | |
| spectrometr_separate.ex4 | 2013-06-06 13:12 | 19K | |
| speed_ind.ex4 | 2013-06-06 13:12 | 4.1K | |
| spread alert.ex4 | 2013-06-06 13:12 | 1.9K | |
| spyker.ex4 | 2013-06-06 13:12 | 2.5K | |
| squeeze_break.ex4 | 2013-06-06 13:12 | 7.9K | |
| srdc_iii_tester.ex4 | 2013-06-06 13:12 | 11K | |
| ssl_channel_chart.ex4 | 2013-06-06 13:12 | 4.2K | |
| st_ind_2.ex4 | 2013-06-06 13:12 | 4.1K | |
| stalin.ex4 | 2013-06-06 13:12 | 6.0K | |
| standard deviation channels.ex4 | 2013-06-06 13:12 | 2.4K | |
| starc bands.ex4 | 2013-06-06 13:12 | 3.2K | |
| starter.ex4 | 2013-06-06 13:12 | 4.6K | |
| stddeviationea.ex4 | 2013-06-06 13:12 | 8.6K | |
| stddivbands.ex4 | 2013-06-06 13:12 | 3.0K | |
| stealth.ex4 | 2013-06-06 13:12 | 3.3K | |
| stealthstoploss.ex4 | 2013-06-06 13:12 | 3.7K | |
| stepchoppy_v1.ex4 | 2013-06-06 13:12 | 7.6K | |
| stepchoppy_v1[1].2.ex4 | 2013-06-06 13:12 | 8.0K | |
| stepchoppy_v1[1].3.ex4 | 2013-06-06 13:12 | 8.5K | |
| stepchoppybars_v1.ex4 | 2013-06-06 13:12 | 6.5K | |
| stepma_3d_v1.ex4 | 2013-06-06 13:12 | 6.4K | |
| stepma_3d_v3.ex4 | 2013-06-06 13:12 | 10K | |
| stepma_color_v2.ex4 | 2013-06-06 13:12 | 3.7K | |
| stepma_stoch_signalalert.ex4 | 2013-06-06 13:12 | 3.1K | |
| stepma_stoch_v1.ex4 | 2013-06-06 13:12 | 5.9K | |
| stepma_v1.ex4 | 2013-06-06 13:12 | 2.9K | |
| stepma_v3.ex4 | 2013-06-06 13:12 | 3.4K | |
| stepma_v7.ex4 | 2013-06-06 13:12 | 7.1K | |
| stepma_v7a.ex4 | 2013-06-06 13:12 | 8.1K | |
| steprsi_v5.2.ex4 | 2013-06-06 13:12 | 5.1K | |
| stepsto_v1.ex4 | 2013-06-06 13:12 | 4.2K | |
| stlm_hist.ex4 | 2013-06-06 13:12 | 30K | |
| stocasticsonpricechart.ex4 | 2013-06-06 13:12 | 3.1K | |
| stocasticsonpricechart1.ex4 | 2013-06-06 13:12 | 3.1K | |
| stocasticsonpricechartextreme.ex4 | 2013-06-06 13:12 | 4.0K | |
| stochastic (2).ex4 | 2013-06-06 13:12 | 4.0K | |
| stochastic.ex4 | 2013-06-06 13:12 | 4.0K | |
| stochastic3_v2.ex4 | 2013-06-06 13:12 | 6.1K | |
| stochastic_cross_alert.ex4 | 2013-06-06 13:12 | 6.0K | |
| stochastic_divergencemtf.ex4 | 2013-06-06 13:12 | 13K | |
| stochastic_mtf_w-alert.ex4 | 2013-06-06 13:12 | 5.8K | |
| stochasticexpansion_v1.1.ex4 | 2013-06-06 13:12 | 4.4K | |
| stochasticstack.ex4 | 2013-06-06 13:12 | 6.6K | |
| stochastictrad.ex4 | 2013-06-06 13:12 | 4.4K | |
| stochcci_arrows_v7.ex4 | 2013-06-06 13:12 | 4.2K | |
| stochcrossalert.ex4 | 2013-06-06 13:12 | 3.3K | |
| stochhistogram.ex4 | 2013-06-06 13:12 | 3.0K | |
| stochscalp^^2^^.ex4 | 2013-06-06 13:12 | 9.0K | |
| stocrsi 2.ex4 | 2013-06-06 13:12 | 4.6K | |
| stop_reversal.ex4 | 2013-06-06 13:12 | 3.3K | |
| stop_reversal_bluestops.ex4 | 2013-06-06 13:12 | 5.7K | |
| stop_reversal_mod.ex4 | 2013-06-06 13:12 | 5.4K | |
| stop reversal.ex4 | 2013-06-06 13:12 | 3.3K | |
| straddle&trail.ex4 | 2013-06-06 13:12 | 36K | |
| strangeindicator.ex4 | 2013-06-06 13:12 | 2.1K | |
| streamampzz.ex4 | 2013-06-06 13:12 | 10K | |
| supdem.ex4 | 2013-06-06 13:12 | 13K | |
| super-signals-channel.ex4 | 2013-06-06 13:12 | 2.8K | |
| super-signals-channel1.ex4 | 2013-06-06 13:12 | 3.0K | |
| super-signals.ex4 | 2013-06-06 13:12 | 2.4K | |
| super-signals_test.ex4 | 2013-06-06 13:12 | 3.2K | |
| super-signals_v1.ex4 | 2013-06-06 13:12 | 2.4K | |
| super-signals_v2.ex4 | 2013-06-06 13:12 | 2.4K | |
| super_trend.ex4 | 2013-06-06 13:12 | 6.2K | |
| super_trend2.ex4 | 2013-06-06 13:12 | 8.6K | |
| superprofit.ex4 | 2013-06-06 13:12 | 6.3K | |
| superscalper_v1.ex4 | 2013-06-06 13:12 | 18K | |
| supersr 6.ex4 | 2013-06-06 13:12 | 3.7K | |
| supersr7.ex4 | 2013-06-06 13:12 | 3.8K | |
| supertrend.ex4 | 2013-06-06 13:12 | 3.2K | |
| supertrend audible alert.ex4 | 2013-06-06 13:12 | 3.9K | |
| supertrendbar.ex4 | 2013-06-06 13:12 | 9.3K | |
| superwoodiecci.ex4 | 2013-06-06 13:12 | 3.6K | |
| support and resistance.ex4 | 2013-06-06 13:12 | 2.3K | |
| support resistance.ex4 | 2013-06-06 13:12 | 8.6K | |
| supresmultiframe.ex4 | 2013-06-06 13:12 | 8.0K | |
| sve rsi i-fish.ex4 | 2013-06-06 13:12 | 9.9K | |
| swapshop.ex4 | 2013-06-06 13:12 | 4.1K | |
| swing_point.ex4 | 2013-06-06 13:12 | 3.2K | |
| swing_zz_with_alert.ex4 | 2013-06-06 13:12 | 13K | |
| swing zig zag sound alert.ex4 | 2013-06-06 13:12 | 13K | |
| swisscheese.ex4 | 2013-06-06 13:12 | 6.5K | |
| swissy.ex4 | 2013-06-06 13:12 | 2.6K | |
| synergybasic2.ex4 | 2013-06-06 13:12 | 9.3K | |
| synergyind.ex4 | 2013-06-06 13:12 | 19K | |
| t3 -trix.ex4 | 2013-06-06 13:12 | 6.0K | |
| t3.ex4 | 2013-06-06 13:12 | 4.4K | |
| t3_adx_+di_-di_burst.ex4 | 2013-06-06 13:12 | 4.6K | |
| t3_dpo-v1.ex4 | 2013-06-06 13:12 | 3.4K | |
| t3_ianchmom.ex4 | 2013-06-06 13:12 | 3.7K | |
| t3_ianchmom_hist.ex4 | 2013-06-06 13:12 | 4.1K | |
| t3_ma.ex4 | 2013-06-06 13:12 | 3.1K | |
| t3_maco.ex4 | 2013-06-06 13:12 | 3.2K | |
| t3_moving_volume_average.ex4 | 2013-06-06 13:12 | 2.9K | |
| t3_rsi.ex4 | 2013-06-06 13:12 | 3.3K | |
| t3 bands.ex4 | 2013-06-06 13:12 | 8.6K | |
| t3 cci.ex4 | 2013-06-06 13:12 | 3.0K | |
| t3ma.ex4 | 2013-06-06 13:12 | 4.3K | |
| t3 maco.ex4 | 2013-06-06 13:12 | 3.2K | |
| t3maco.ex4 | 2013-06-06 13:12 | 3.2K | |
| t3maopt.ex4 | 2013-06-06 13:12 | 3.3K | |
| t3 rsi.ex4 | 2013-06-06 13:12 | 3.3K | |
| t3 taotra.ex4 | 2013-06-06 13:12 | 9.9K | |
| t3 trix (roc of t6).ex4 | 2013-06-06 13:12 | 6.0K | |
| t3 trix crossing signals.ex4 | 2013-06-06 13:12 | 4.1K | |
| ta_1.12.ex4 | 2013-06-06 13:12 | 11K | |
| ta_1.14.ex4 | 2013-06-06 13:12 | 18K | |
| taf.ex4 | 2013-06-06 13:12 | 2.9K | |
| take profit - stop lose calculator .ex4 | 2013-06-06 13:12 | 11K | |
| td_points&line_auto.ex4 | 2013-06-06 13:12 | 15K | |
| td_points&line_mgtd1.ex4 | 2013-06-06 13:12 | 12K | |
| td_sequential_v2.ex4 | 2013-06-06 13:12 | 11K | |
| tdi-2.ex4 | 2013-06-06 13:12 | 3.8K | |
| tdi-with alerts.ex4 | 2013-06-06 13:12 | 19K | |
| tdi.ex4 | 2013-06-06 13:12 | 3.6K | |
| td sequential.ex4 | 2013-06-06 13:12 | 5.0K | |
| tema-rv.ex4 | 2013-06-06 13:12 | 4.2K | |
| tema_rlh.ex4 | 2013-06-06 13:12 | 3.0K | |
| test1.ex4 | 2013-06-06 13:12 | 3.0K | |
| test2.ex4 | 2013-06-06 13:12 | 3.5K | |
| test3.ex4 | 2013-06-06 13:12 | 2.2K | |
| test4_5ticks.ex4 | 2013-06-06 13:12 | 3.7K | |
| test4_show5ticks.ex4 | 2013-06-06 13:12 | 2.5K | |
| test_3expert.ex4 | 2013-06-06 13:12 | 3.5K | |
| test_5close_up.ex4 | 2013-06-06 13:12 | 4.7K | |
| test_5close_up_v31.ex4 | 2013-06-06 13:12 | 4.4K | |
| test_5typ_up.ex4 | 2013-06-06 13:12 | 4.3K | |
| test_fatl.ex4 | 2013-06-06 13:12 | 9.6K | |
| test_histo2.ex4 | 2013-06-06 13:12 | 2.6K | |
| test_shownticks.ex4 | 2013-06-06 13:12 | 2.6K | |
| test_volume.ex4 | 2013-06-06 13:12 | 1.7K | |
| test last 100.ex4 | 2013-06-06 13:12 | 2.3K | |
| the 20's indicator [i].ex4 | 2013-06-06 13:12 | 3.9K | |
| the 20's v0.20.ex4 | 2013-06-06 13:12 | 3.9K | |
| thma.ex4 | 2013-06-06 13:12 | 3.1K | |
| three_color.ex4 | 2013-06-06 13:12 | 3.0K | |
| three_color_ma.ex4 | 2013-06-06 13:12 | 3.0K | |
| three day rolling pivot.ex4 | 2013-06-06 13:12 | 4.4K | |
| three line break.ex4 | 2013-06-06 13:12 | 4.0K | |
| thv 2 4 tf trixhisto barv3.1.5.3-1.ex4 | 2013-06-06 13:12 | 22K | |
| thv 2 4 tf trixhisto barv3.1.5.3.ex4 | 2013-06-06 13:12 | 22K | |
| thv3 atr pips.ex4 | 2013-06-06 13:12 | 2.6K | |
| thv3 candleclock.ex4 | 2013-06-06 13:12 | 4.7K | |
| thv3 coral.ex4 | 2013-06-06 13:12 | 16K | |
| thv3 coral_thick.ex4 | 2013-06-06 13:12 | 16K | |
| thv3 ffcal.ex4 | 2013-06-06 13:12 | 33K | |
| thv3 ha.ex4 | 2013-06-06 13:12 | 3.2K | |
| thv3 ichimoku cloud histo barv3.1.2.ex4 | 2013-06-06 13:12 | 8.9K | |
| thv3 market hours.ex4 | 2013-06-06 13:12 | 9.8K | |
| thv3 mmprice.ex4 | 2013-06-06 13:12 | 3.3K | |
| thv3 sdx-tzpivots_v4.ex4 | 2013-06-06 13:12 | 27K | |
| thv3 spreadandrange.ex4 | 2013-06-06 13:12 | 16K | |
| thv3 t3.ex4 | 2013-06-06 13:12 | 4.4K | |
| thv3 trend.ex4 | 2013-06-06 13:12 | 4.7K | |
| thv3 trix called.ex4 | 2013-06-06 13:12 | 28K | |
| thv3 trix for mtfhisto.ex4 | 2013-06-06 13:12 | 30K | |
| thv3 trix v4.01 div.ex4 | 2013-06-06 13:12 | 30K | |
| thv ichimoku cloud histo barv3.1.1.ex4 | 2013-06-06 13:12 | 8.8K | |
| thv l v2a-1.ex4 | 2013-06-06 13:12 | 2.8K | |
| thv l v2a.ex4 | 2013-06-06 13:12 | 2.8K | |
| thv mtf trixhisto barv5.0.3.ex4 | 2013-06-06 13:12 | 22K | |
| thv rsi_v2.ex4 | 2013-06-06 13:12 | 11K | |
| tick_on_chart.ex4 | 2013-06-06 13:12 | 2.9K | |
| ticker.ex4 | 2013-06-06 13:12 | 3.2K | |
| ticker awesome oscillator.ex4 | 2013-06-06 13:12 | 4.8K | |
| ticker fatl.ex4 | 2013-06-06 13:12 | 5.3K | |
| ticker fatl satl.ex4 | 2013-06-06 13:12 | 10K | |
| ticker macd.ex4 | 2013-06-06 13:12 | 4.6K | |
| ticker trail.ex4 | 2013-06-06 13:12 | 3.1K | |
| time-box.ex4 | 2013-06-06 13:12 | 5.2K | |
| time.ex4 | 2013-06-06 13:12 | 2.3K | |
| time1.ex4 | 2013-06-06 13:12 | 4.1K | |
| time1_modified.ex4 | 2013-06-06 13:12 | 5.9K | |
| time2.ex4 | 2013-06-06 13:12 | 4.6K | |
| time_zones.ex4 | 2013-06-06 13:12 | 7.6K | |
| time_zones1.ex4 | 2013-06-06 13:12 | 7.6K | |
| time to next bar.ex4 | 2013-06-06 13:12 | 3.7K | |
| timing.ex4 | 2013-06-06 13:12 | 4.1K | |
| tipama.ex4 | 2013-06-06 13:12 | 3.0K | |
| tma.ex4 | 2013-06-06 13:12 | 3.5K | |
| tmmultipletf.ex4 | 2013-06-06 13:12 | 3.8K | |
| today trend.ex4 | 2013-06-06 13:12 | 6.9K | |
| today trend_ruduga.ex4 | 2013-06-06 13:12 | 6.9K | |
| today trend last.ex4 | 2013-06-06 13:12 | 6.9K | |
| tor_1.20k.ex4 | 2013-06-06 13:12 | 8.7K | |
| trade_sessions.ex4 | 2013-06-06 13:12 | 6.3K | |
| tradearoundpivot.ex4 | 2013-06-06 13:12 | 9.7K | |
| tradechannel.ex4 | 2013-06-06 13:12 | 9.7K | |
| traders_dynamic_index.ex4 | 2013-06-06 13:12 | 4.8K | |
| traders_dynamic_index_visual_alerts.ex4 | 2013-06-06 13:12 | 22K | |
| tradesig.ex4 | 2013-06-06 13:12 | 2.0K | |
| tradesig_v6.ex4 | 2013-06-06 13:12 | 3.8K | |
| tradetime_v2.ex4 | 2013-06-06 13:12 | 3.9K | |
| trading hours.ex4 | 2013-06-06 13:12 | 2.6K | |
| tradingtimesfilter_ea.ex4 | 2013-06-06 13:12 | 3.0K | |
| traditional itrend.ex4 | 2013-06-06 13:12 | 3.9K | |
| trailing.ex4 | 2013-06-06 13:12 | 18K | |
| trailingstop.ex4 | 2013-06-06 13:12 | 8.1K | |
| trailing stop loss - level.ex4 | 2013-06-06 13:12 | 3.5K | |
| trailing stop v_tdavid.ex4 | 2013-06-06 13:12 | 2.7K | |
| trailingwithpartialclose.ex4 | 2013-06-06 13:12 | 23K | |
| trailme.ex4 | 2013-06-06 13:12 | 16K | |
| trand.ex4 | 2013-06-06 13:12 | 3.0K | |
| trend(23sep05).ex4 | 2013-06-06 13:12 | 3.5K | |
| trend.ex4 | 2013-06-06 13:12 | 3.5K | |
| trend1.ex4 | 2013-06-06 13:12 | 3.5K | |
| trend_alexcud_v_2.ex4 | 2013-06-06 13:12 | 23K | |
| trend_cf.ex4 | 2013-06-06 13:12 | 3.5K | |
| trend_manager.ex4 | 2013-06-06 13:12 | 2.6K | |
| trend_manager2.ex4 | 2013-06-06 13:12 | 6.1K | |
| trend_smc.ex4 | 2013-06-06 13:12 | 2.4K | |
| trend bands.ex4 | 2013-06-06 13:12 | 2.9K | |
| trendcontinuation.ex4 | 2013-06-06 13:12 | 5.3K | |
| trenddinamicindex.ex4 | 2013-06-06 13:12 | 22K | |
| trendema.ex4 | 2013-06-06 13:12 | 2.8K | |
| trendenvelopes_v1.ex4 | 2013-06-06 13:12 | 5.0K | |
| trendenvelopes_v2.ex4 | 2013-06-06 13:12 | 4.8K | |
| trend friend follow.ex4 | 2013-06-06 13:12 | 16K | |
| trendline.ex4 | 2013-06-06 13:12 | 3.3K | |
| trendlineorder.ex4 | 2013-06-06 13:12 | 9.8K | |
| trendlineorder_mail.ex4 | 2013-06-06 13:12 | 11K | |
| trendlines.ex4 | 2013-06-06 13:12 | 13K | |
| trendlines2.ex4 | 2013-06-06 13:12 | 16K | |
| trend magic.ex4 | 2013-06-06 13:12 | 3.0K | |
| trend manager.ex4 | 2013-06-06 13:12 | 2.6K | |
| trendmanager.ex4 | 2013-06-06 13:12 | 2.6K | |
| trendmanager_recentweight.ex4 | 2013-06-06 13:12 | 3.1K | |
| trendmanagerfiltered.ex4 | 2013-06-06 13:12 | 6.7K | |
| trend manager indicator.ex4 | 2013-06-06 13:12 | 3.1K | |
| trendmanagernt.ex4 | 2013-06-06 13:12 | 7.7K | |
| trendmanageropen2.ex4 | 2013-06-06 13:12 | 3.4K | |
| trend manager open2 separate window.ex4 | 2013-06-06 13:12 | 3.2K | |
| trendmanageropen2 seperate window.ex4 | 2013-06-06 13:12 | 3.4K | |
| trendmanagerwithbuffet.ex4 | 2013-06-06 13:12 | 5.8K | |
| trendmanagerwithtrigger.ex4 | 2013-06-06 13:12 | 10K | |
| trendmaster_forex_indicator_v1.1.ex4 | 2013-06-06 13:12 | 11K | |
| trendpower.ex4 | 2013-06-06 13:12 | 3.7K | |
| trend rider.ex4 | 2013-06-06 13:12 | 8.1K | |
| trendscalpindc_pp.ex4 | 2013-06-06 13:12 | 4.5K | |
| trendscalpindic.ex4 | 2013-06-06 13:12 | 3.7K | |
| trendsignal.ex4 | 2013-06-06 13:12 | 4.9K | |
| trend smc.ex4 | 2013-06-06 13:12 | 2.4K | |
| trend smc v2.ex4 | 2013-06-06 13:12 | 3.0K | |
| trendstrength.ex4 | 2013-06-06 13:12 | 3.0K | |
| trendstrengthtrio.ex4 | 2013-06-06 13:12 | 4.3K | |
| trend trigger (bars).ex4 | 2013-06-06 13:12 | 3.9K | |
| trendtriggermod.ex4 | 2013-06-06 13:12 | 4.1K | |
| trend trigger modified(6aug05).ex4 | 2013-06-06 13:12 | 3.5K | |
| trend trigger modified.ex4 | 2013-06-06 13:12 | 3.5K | |
| triangular arbitrage.ex4 | 2013-06-06 13:12 | 4.9K | |
| triangularma.ex4 | 2013-06-06 13:12 | 3.5K | |
| triangulatma.ex4 | 2013-06-06 13:12 | 3.5K | |
| trigger line.ex4 | 2013-06-06 13:12 | 3.3K | |
| triggerlines.ex4 | 2013-06-06 13:12 | 3.3K | |
| triggerlines1.ex4 | 2013-06-06 13:12 | 3.3K | |
| triplema_crossover_ea.ex4 | 2013-06-06 13:12 | 17K | |
| tripleplay.ex4 | 2013-06-06 13:12 | 19K | |
| tripleplaytesting.ex4 | 2013-06-06 13:12 | 31K | |
| trix.ex4 | 2013-06-06 13:12 | 4.5K | |
| trix_a.ex4 | 2013-06-06 13:12 | 4.0K | |
| tsd_pp_macd_force_ind_v1.ex4 | 2013-06-06 13:12 | 4.0K | |
| tsi-osc(4aug05).ex4 | 2013-06-06 13:12 | 3.9K | |
| tsi-osc.ex4 | 2013-06-06 13:12 | 3.9K | |
| tsi.ex4 | 2013-06-06 13:12 | 3.2K | |
| tsi_signals.ex4 | 2013-06-06 13:12 | 3.3K | |
| tsi signals.ex4 | 2013-06-06 13:12 | 3.3K | |
| tsr_ranges.ex4 | 2013-06-06 13:12 | 4.4K | |
| ttf+-+mw.ex4 | 2013-06-06 13:12 | 4.1K | |
| ttf - trigger factor.ex4 | 2013-06-06 13:12 | 4.8K | |
| ttf.ex4 | 2013-06-06 13:12 | 4.8K | |
| ttf_hist.ex4 | 2013-06-06 13:12 | 4.9K | |
| ttf_look-ahead.ex4 | 2013-06-06 13:12 | 4.9K | |
| ttf_tr.ex4 | 2013-06-06 13:12 | 3.4K | |
| ttm-trend.ex4 | 2013-06-06 13:12 | 4.0K | |
| ttm.ex4 | 2013-06-06 13:12 | 3.0K | |
| tunnel.ex4 | 2013-06-06 13:12 | 6.5K | |
| turbo_jma.ex4 | 2013-06-06 13:12 | 10K | |
| turbo_jrsx.ex4 | 2013-06-06 13:12 | 3.8K | |
| turbo_jvel.ex4 | 2013-06-06 13:12 | 11K | |
| two lines.ex4 | 2013-06-06 13:12 | 3.4K | |
| tz-breaktout.ex4 | 2013-06-06 13:12 | 7.5K | |
| ultimate_oscillator.ex4 | 2013-06-06 13:12 | 3.4K | |
| ultitimate oscillator.ex4 | 2013-06-06 13:12 | 2.2K | |
| up_down.ex4 | 2013-06-06 13:12 | 21K | |
| urovni-mt4.ex4 | 2013-06-06 13:12 | 12K | |
| v-t&bv6.ex4 | 2013-06-06 13:12 | 6.3K | |
| valasholic13 v2.5.ex4 | 2013-06-06 13:12 | 8.7K | |
| var_mov_avg.ex4 | 2013-06-06 13:12 | 3.7K | |
| variation.ex4 | 2013-06-06 13:12 | 2.5K | |
| var mov avg.ex4 | 2013-06-06 13:12 | 3.7K | |
| vegas.ex4 | 2013-06-06 13:12 | 6.5K | |
| vegas1hr.ex4 | 2013-06-06 13:12 | 6.5K | |
| vegas_currency_daily.ex4 | 2013-06-06 13:12 | 6.5K | |
| vegas_s_p_daily.ex4 | 2013-06-06 13:12 | 6.5K | |
| vegascurrencydaily.ex4 | 2013-06-06 13:12 | 6.5K | |
| vegass&pdaily.ex4 | 2013-06-06 13:12 | 6.5K | |
| vertical_lines.ex4 | 2013-06-06 13:12 | 6.0K | |
| vertical line.ex4 | 2013-06-06 13:12 | 2.0K | |
| vertical lines sample.ex4 | 2013-06-06 13:12 | 6.0K | |
| vhf_v1.ex4 | 2013-06-06 13:12 | 3.3K | |
| virtual-trade-monitor-v2.1.ex4 | 2013-06-06 13:12 | 29K | |
| visualtrend v1.ex4 | 2013-06-06 13:12 | 22K | |
| volatility.ex4 | 2013-06-06 13:12 | 3.5K | |
| volatility.pivot.ex4 | 2013-06-06 13:12 | 3.6K | |
| volatility2.ex4 | 2013-06-06 13:12 | 2.4K | |
| volatility quality.ex4 | 2013-06-06 13:12 | 11K | |
| volume with custom ma.ex4 | 2013-06-06 13:12 | 6.1K | |
| vq.ex4 | 2013-06-06 13:12 | 11K | |
| vs_chaneltrend_v1.0.ex4 | 2013-06-06 13:12 | 16K | |
| vsi.ex4 | 2013-06-06 13:12 | 2.8K | |
| vts_vg_ts.ex4 | 2013-06-06 13:12 | 7.1K | |
| vts_vg_ts_setka.ex4 | 2013-06-06 13:12 | 8.3K | |
| waddah_attar_def_rsi.ex4 | 2013-06-06 13:12 | 2.5K | |
| waddah attar adxxbollinger.ex4 | 2013-06-06 13:12 | 2.7K | |
| wcci.ex4 | 2013-06-06 13:12 | 3.2K | |
| wccichart.ex4 | 2013-06-06 13:12 | 4.5K | |
| wccipatterns.ex4 | 2013-06-06 13:12 | 22K | |
| weeklybreak.ex4 | 2013-06-06 13:12 | 2.5K | |
| weeklyhilo.ex4 | 2013-06-06 13:12 | 3.6K | |
| weeklypivot.ex4 | 2013-06-06 13:12 | 5.5K | |
| weeklypivotonly.ex4 | 2013-06-06 13:12 | 5.3K | |
| weightedcci.ex4 | 2013-06-06 13:12 | 4.6K | |
| wellxama.ex4 | 2013-06-06 13:12 | 3.6K | |
| william36histogramwallertest.ex4 | 2013-06-06 13:12 | 4.5K | |
| wiseman.ex4 | 2013-06-06 13:12 | 2.3K | |
| wisemanao.ex4 | 2013-06-06 13:12 | 3.9K | |
| wlxbwacsig.ex4 | 2013-06-06 13:12 | 4.2K | |
| wlxbwwiseman-2.ex4 | 2013-06-06 13:12 | 3.0K | |
| wlxfractals.ex4 | 2013-06-06 13:12 | 4.2K | |
| wolf.ex4 | 2013-06-06 13:12 | 13K | |
| wolfwave_nen.ex4 | 2013-06-06 13:12 | 16K | |
| woodiescci.ex4 | 2013-06-06 13:12 | 3.2K | |
| wpr.ex4 | 2013-06-06 13:12 | 2.4K | |
| wprfast.ex4 | 2013-06-06 13:12 | 2.8K | |
| wprslow.ex4 | 2013-06-06 13:12 | 2.8K | |
| wsowrotrend.ex4 | 2013-06-06 13:12 | 6.3K | |
| x-wave-elliot(21-13-8-1).ex4 | 2013-06-06 13:12 | 15K | |
| xfe-i_trend.ex4 | 2013-06-06 13:12 | 3.4K | |
| xfe-juice.ex4 | 2013-06-06 13:12 | 3.1K | |
| xfe-laguerre.ex4 | 2013-06-06 13:12 | 2.8K | |
| xfe-perkyasctrend1.ex4 | 2013-06-06 13:12 | 5.2K | |
| xfe-shi_channel.ex4 | 2013-06-06 13:12 | 6.1K | |
| xma.ex4 | 2013-06-06 13:12 | 3.8K | |
| xmeter_indicator2_updated.ex4 | 2013-06-06 13:12 | 12K | |
| xo.ex4 | 2013-06-06 13:12 | 2.8K | |
| xpma.ex4 | 2013-06-06 13:12 | 4.5K | |
| xpma_v2satl.ex4 | 2013-06-06 13:12 | 5.0K | |
| xpp-indicator.ex4 | 2013-06-06 13:12 | 4.0K | |
| xprofuterdd.ex4 | 2013-06-06 13:12 | 3.5K | |
| xprofuteroverlay.ex4 | 2013-06-06 13:12 | 2.3K | |
| yangtrader.ex4 | 2013-06-06 13:12 | 2.4K | |
| yangtradermain.ex4 | 2013-06-06 13:12 | 3.7K | |
| zerolag macd.ex4 | 2013-06-06 13:12 | 3.8K | |
| zerolagstochs.ex4 | 2013-06-06 13:12 | 3.4K | |
| zerolagstochs_b.ex4 | 2013-06-06 13:12 | 3.7K | |
| zerolagstochssignals.ex4 | 2013-06-06 13:12 | 2.9K | |
| zig_zag_breakout.ex4 | 2013-06-06 13:12 | 11K | |
| zigzag (2).ex4 | 2013-06-06 13:12 | 4.1K | |
| zigzag(11aug05).ex4 | 2013-06-06 13:12 | 4.1K | |
| zigzag+.ex4 | 2013-06-06 13:12 | 11K | |
| zigzag.ex4 | 2013-06-06 13:12 | 4.1K | |
| zigzag1.ex4 | 2013-06-06 13:12 | 4.0K | |
| zigzag_fibo_v1beta.ex4 | 2013-06-06 13:12 | 5.0K | |
| zigzag_fibo_v2beta.ex4 | 2013-06-06 13:12 | 5.0K | |
| zigzagfirst.ex4 | 2013-06-06 13:12 | 3.9K | |
| zigzag pointer.ex4 | 2013-06-06 13:12 | 4.1K | |
| zup_v14.ex4 | 2013-06-06 13:12 | 51K | |
| zup_v64.ex4 | 2013-06-06 13:12 | 214K | |
| zup_v71.ex4 | 2013-06-06 13:12 | 252K | |
| zup_v76_5-0_mod.ex4 | 2013-06-06 13:12 | 305K | |
| zup_v78.ex4 | 2013-06-06 13:12 | 301K | |
| zz mtf xo a.ex4 | 2013-06-06 13:12 | 3.0K | |