Worksheet # 8 Quarter 4 Packet 5

Name_______________________________ Date_______________________ Class__________

Esters                              


1.Name the carboxylic acid with the
  Following condensed structural formula:
  CH3(CH2)5COOH




2. Name the carboxylic acid with the
   Following condensed structural formula:
  CH3CH2CH(CH3)(CH2)2COOH




3.Name the carboxylic acid with the
  following condensed structural formula:      CH3(CH2)2CH(CH3)(CH2)3COOH




4. Write the  structural formula for
     propanoic acid.




5. Write the structural formula for octanoic acid




6.Name the carboxylic acid with the 
  following condensed structural formula:
  CH3CH(CH3)COOH 
 


7. Name the carboxylic acid with the
following condensed structural formula:
CH3(CH2)3COOH




8. Write the  structural formula
for nonanoic acid



9. Write the structural formula for ethanol.


10. Write the structural formula for 
       decanoic acid.             




11. What is the name for the ester derived
      from the reaction between ethanol and
      butanoic acid?  Write its structural formula.



12. What is the name for the ester derive from
       the reaction between propanol and
      pentanoic acid?  Write its structural formula.
 



13. What is the name of the ester derived from
      the reaction between methanol and
      ethanoic acid?  Write its structural formula.




14. What is the name of the ester derived from
      the reaction between ethanol and octanoic
     acid?  Write its structural formula.




15. Write a structural formula for
      butyl propanoate.




16. What is the name of the ester derived from
      the reaction between methanol and
     methanoic acid?   Write its structural formula.



17. Write the structural formula for propyl butanoate.



18.What is the name of the ester derived from the reaction between ethanol and
propanoic acid?  Write its structural formula.




19. What is the name of the ester derived from the reaction between methanol and heptanoic acid?  Write its structural formula.




20. What is the name of the ester derived from the reaction between butanol and
Pentanoic acid?  Write its structural formula.
Hosted by www.Geocities.ws

1